(S)-(+)-1-PHENYL-1,2-ETHANEDIOL 2-TOSYLATE structure
|
Common Name | (S)-(+)-1-PHENYL-1,2-ETHANEDIOL 2-TOSYLATE | ||
|---|---|---|---|---|
| CAS Number | 40435-14-1 | Molecular Weight | 292.350 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 480.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O4S | Melting Point | 74-76ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 244.5±27.3 °C | |
| Name | (S)-(+)-1-Phenyl-1,2-Ethanediol 2-Tosylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 480.6±40.0 °C at 760 mmHg |
| Melting Point | 74-76ºC(lit.) |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.350 |
| Flash Point | 244.5±27.3 °C |
| Exact Mass | 292.076935 |
| PSA | 71.98000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | IOTJIFRGXYQHAQ-OAHLLOKOSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)c2ccccc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2906299090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| (2S)-2-Hydroxy-2-phenylethyl 4-methylbenzenesulfonate |
| [(2S)-2-hydroxy-2-phenylethyl] 4-methylbenzenesulfonate |
| 1,2-Ethanediol, 1-phenyl-, 2-(4-methylbenzenesulfonate), (1S)- |
| MFCD00013428 |
| (S)-(+)-1-Phenyl-1,2-ethanediol 2-tosylate |