4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-N,N-dimethylaniline structure
|
Common Name | 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 40442-45-3 | Molecular Weight | 330.44600 | |
| Density | 1.263g/cm3 | Boiling Point | 555ºC at 760 mmHg | |
| Molecular Formula | C21H18N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.5ºC | |
| Name | 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 555ºC at 760 mmHg |
| Molecular Formula | C21H18N2S |
| Molecular Weight | 330.44600 |
| Flash Point | 289.5ºC |
| Exact Mass | 330.11900 |
| PSA | 44.37000 |
| LogP | 5.68590 |
| Index of Refraction | 1.783 |
| InChIKey | ODPLCKKBVAJQEP-NTEUORMPSA-N |
| SMILES | CN(C)c1ccc(C=Cc2nc3c(ccc4ccccc43)s2)cc1 |
|
~%
4-[(E)-2-benzo[... CAS#:40442-45-3 |
| Literature: Brown; Kon Journal of the Chemical Society, 1948 , p. 2147,2153 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-dimethyl-4-(trans-2-naphtho[1,2-d]thiazol-2-yl-vinyl)-aniline |