2,2,2-trifluoroethyl N-(4-nitrophenyl)carbamate structure
|
Common Name | 2,2,2-trifluoroethyl N-(4-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 405-59-4 | Molecular Weight | 264.15800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoroethyl N-(4-nitrophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7F3N2O4 |
|---|---|
| Molecular Weight | 264.15800 |
| Exact Mass | 264.03600 |
| PSA | 84.15000 |
| LogP | 3.30180 |
| InChIKey | IXDWKZKYSUXWGC-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)OCC(F)(F)F |
| HS Code | 2924299090 |
|---|
|
~%
2,2,2-trifluoro... CAS#:405-59-4 |
| Literature: Oliverio; Sawicki Journal of Organic Chemistry, 1955 , vol. 20, p. 363,364 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid,(4-nitrophenyl)-,2,2,2-trifluoroethyl ester |
| (4-nitro-phenyl)-carbamic acid-(2,2,2-trifluoro-ethyl ester) |
| (4-Nitro-phenyl)-carbamidsaeure-(2,2,2-trifluor-aethylester) |
| 2.2.2-Trifluorethyl-N-(p-nitrophenyl)carbamat |