Diisobutyl 2,3-dihydroxysuccinate structure
|
Common Name | Diisobutyl 2,3-dihydroxysuccinate | ||
|---|---|---|---|---|
| CAS Number | 4054-82-4 | Molecular Weight | 262.29900 | |
| Density | 1.139g/cm3 | Boiling Point | 324ºC at 760mmHg | |
| Molecular Formula | C12H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.1ºC | |
| Name | Diisobutyl 2,3-dihydroxysuccinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 324ºC at 760mmHg |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.29900 |
| Flash Point | 114.1ºC |
| Exact Mass | 262.14200 |
| PSA | 93.06000 |
| LogP | 0.10660 |
| InChIKey | ONZOGXRINCURBP-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C(O)C(O)C(=O)OCC(C)C |
| HS Code | 2918130000 |
|---|
|
~%
Diisobutyl 2,3-... CAS#:4054-82-4 |
| Literature: Campbell Journal of the Chemical Society, 1929 , p. 1117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918130000 |
|---|---|
| Summary | 2918130000 salts and esters of tartaric acid。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Diisobutylracemat |
| Butanedioic acid,2,3-dihydroxy-,bis(2-methylpropyl) ester |
| Weinsaeure-diisobutylester |
| Einecs 223-763-3 |
| 2,3-dihydroxy-succinic acid diisobutyl ester |
| Diisobutyl-tartrat |
| 2,3-Dihydroxybutanedioic acid di(2-methylpropyl) ester |
| Traubensaeurediisobutylester |
| tartaric acid diisobutyl ester |
| diisobutyl tartrate |