butyl-tri(propan-2-yloxy)stannane structure
|
Common Name | butyl-tri(propan-2-yloxy)stannane | ||
|---|---|---|---|---|
| CAS Number | 40542-28-7 | Molecular Weight | 353.07700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H30O3Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl-tri(propan-2-yloxy)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H30O3Sn |
|---|---|
| Molecular Weight | 353.07700 |
| Exact Mass | 354.12200 |
| PSA | 69.18000 |
| LogP | 3.71570 |
| InChIKey | VEGRTTZOXYUSTI-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](OC(C)C)(OC(C)C)OC(C)C |
|
~0%
butyl-tri(propa... CAS#:40542-28-7 |
| Literature: Plass, Winfried; Verkade, John G. Journal of the American Chemical Society, 1992 , vol. 114, p. 2275 - 2276 |
|
~59%
butyl-tri(propa... CAS#:40542-28-7 |
| Literature: Jaumier, Pascale Chemical Communications, 1998 , # 3 p. 369 - 370 |
|
~67%
butyl-tri(propa... CAS#:40542-28-7 |
| Literature: Banse, Frederic; Ribot, F.; Toledano, P.; Maquet, J.; Sanchez, C. Inorganic Chemistry, 1995 , vol. 34, p. 6371 - 6379 |
| BuSn(OPr(i))3 |
| n-butyltin triisopropoxide |
| butyltin(IV) isopropoxide |
| Triisopropoxybutylzinn |
| Stannane,butyltris(1-methylethoxy) |
| BuSn(OiPr)3 |
| Butyltri-i-propoxystannan |