6-chloro-N-(3-chlorophenyl)pyrimidin-4-amine structure
|
Common Name | 6-chloro-N-(3-chlorophenyl)pyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 405939-02-8 | Molecular Weight | 240.08900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-N-(3-chlorophenyl)pyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7Cl2N3 |
|---|---|
| Molecular Weight | 240.08900 |
| Exact Mass | 239.00200 |
| PSA | 37.81000 |
| LogP | 3.60000 |
| InChIKey | HNMUAQXLESLTKK-UHFFFAOYSA-N |
| SMILES | Clc1cccc(Nc2cc(Cl)ncn2)c1 |
| HS Code | 2933599090 |
|---|
|
~3%
6-chloro-N-(3-c... CAS#:405939-02-8 |
| Literature: Kuo, Gee-Hong; Wang, Aihua; Emanuel, Stuart; DeAngelis, Alan; Zhang, Rui; Connolly, Peter J.; Murray, William V.; Gruninger, Robert H.; Sechler, Jan; Fuentes-Pesquera, Angel; Johnson, Dana; Middleton, Steven A.; Jolliffe, Linda; Chen, Xin Journal of Medicinal Chemistry, 2005 , vol. 48, # 6 p. 1886 - 1900 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-N-(3-chlorophenyl)-4-pyrimidinamine |
| (3-chlorophenyl)(6-chloropyrimidin-4-yl)amine |
| pyrimidin-4-yl)-amine |