N-(1-chloroethenyl)-N,N'-diphenylethanimidamide structure
|
Common Name | N-(1-chloroethenyl)-N,N'-diphenylethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 40626-22-0 | Molecular Weight | 270.75700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1-chloroethenyl)-N,N'-diphenylethanimidamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15ClN2 |
|---|---|
| Molecular Weight | 270.75700 |
| Exact Mass | 270.09200 |
| PSA | 15.60000 |
| LogP | 4.95310 |
| InChIKey | HGQQYCHHNHODTM-UHFFFAOYSA-N |
| SMILES | C=C(Cl)N(C(C)=Nc1ccccc1)c1ccccc1 |
|
~71%
N-(1-chloroethe... CAS#:40626-22-0 |
| Literature: Meth-Cohn, Otto; Westwood, Keith T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2089 - 2092 |
|
~%
N-(1-chloroethe... CAS#:40626-22-0 |
| Literature: Zielinski, W.; Mazik, M. Polish Journal of Chemistry, 1994 , vol. 68, # 3 p. 489 - 498 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Ethanimidamide,N-(1-chloroethenyl)-N,N'-diphenyl |
| N1-(1-chlorovinyl)-N1,N2-diphenylacetamidine |
| N-(1-chlorovinyl)-N,N'-diphenylacetamidine |
| N-(1-Chlor-vinyl)-N,N'-diphenyl-acetamidin |