1,2-bis(1,1,2,2-tetrafluoroethoxy)benzene structure
|
Common Name | 1,2-bis(1,1,2,2-tetrafluoroethoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 4063-48-3 | Molecular Weight | 310.14100 | |
| Density | 1.443g/cm3 | Boiling Point | 97 °C | |
| Molecular Formula | C10H6F8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.3ºC | |
| Name | 1,2-bis(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 97 °C |
| Molecular Formula | C10H6F8O2 |
| Molecular Weight | 310.14100 |
| Flash Point | 85.3ºC |
| Exact Mass | 310.02400 |
| PSA | 18.46000 |
| LogP | 4.16000 |
| Vapour Pressure | 0.34mmHg at 25°C |
| Index of Refraction | 1.3879 |
| InChIKey | TYMCPUUDTMKLGP-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)Oc1ccccc1OC(F)(F)C(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2909309090 |
|
~%
1,2-bis(1,1,2,2... CAS#:4063-48-3 |
| Literature: England,D.C. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 5116 - 5122 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD03424468 |
| Brenzkatechzin-bis-(1,1,2,2-tetrafluor-aethylaether) |
| o-Bis(tetrafluoroethoxy)benzene |