1-(4-(2,2-DICHLOROCYCLOPROPYL)PHENYL)ETHANONE structure
|
Common Name | 1-(4-(2,2-DICHLOROCYCLOPROPYL)PHENYL)ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 40641-93-8 | Molecular Weight | 229.10200 | |
| Density | 1.31g/cm3 | Boiling Point | 349.5ºC at 760 mmHg | |
| Molecular Formula | C11H10Cl2O | Melting Point | 35ºC | |
| MSDS | N/A | Flash Point | 147.6ºC | |
| Name | 1-[4-(2,2-dichlorocyclopropyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 349.5ºC at 760 mmHg |
| Melting Point | 35ºC |
| Molecular Formula | C11H10Cl2O |
| Molecular Weight | 229.10200 |
| Flash Point | 147.6ºC |
| Exact Mass | 228.01100 |
| PSA | 17.07000 |
| LogP | 3.55040 |
| Index of Refraction | 1.575 |
| InChIKey | KCKBGCSOFLKSEH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(C2CC2(Cl)Cl)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| 1-[4-(2,2-dichlorocyclopropyl)phenyl]ethan-1-one |
| 1-(4-(2,2-Dichlorocyclopropyl)phenyl)ethanone |
| HMS560L10 |
| 1-(4-acetylphenyl)-2,2-dichlorocyclopropane |
| p-(2,2-Dichlorcyclopropyl)-acetophenon |