2-(4-Dimethylamino-phenyl)-1H-benzoimidazol-5-yl-amine structure
|
Common Name | 2-(4-Dimethylamino-phenyl)-1H-benzoimidazol-5-yl-amine | ||
|---|---|---|---|---|
| CAS Number | 40655-14-9 | Molecular Weight | 252.31400 | |
| Density | 1.257g/cm3 | Boiling Point | 515.1ºC at 760 mmHg | |
| Molecular Formula | C15H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.3ºC | |
| Name | 2-(4-Dimethylamino-phenyl)-1H-benzoimidazol-5-yl-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 515.1ºC at 760 mmHg |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.31400 |
| Flash Point | 265.3ºC |
| Exact Mass | 252.13700 |
| PSA | 57.94000 |
| LogP | 3.45930 |
| Index of Refraction | 1.726 |
| InChIKey | MYBHZNWJSKGXNY-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2nc3ccc(N)cc3[nH]2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-amine |