3-(furan-2-yl)-1-(2-hydroxy-5-methylphenyl)prop-2-en-1-one structure
|
Common Name | 3-(furan-2-yl)-1-(2-hydroxy-5-methylphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 40664-94-6 | Molecular Weight | 228.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(furan-2-yl)-1-(2-hydroxy-5-methylphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 228.24300 |
| Exact Mass | 228.07900 |
| PSA | 50.44000 |
| LogP | 3.18970 |
| InChIKey | LHWFXYZCYSRHQK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(C(=O)C=Cc2ccco2)c1 |
|
~%
3-(furan-2-yl)-... CAS#:40664-94-6 |
| Literature: Marathe Journal of the University of Poona, Science and Technology, 1958 , # 14 p. 63,66 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(2-furyl)-1-(2-hydroxy-5-methylphenyl)-2-propen-1-one |
| 2-Propen-1-one,3-(2-furanyl)-1-(2-hydroxy-5-methylphenyl) |
| 3-furan-2-yl-1-(2-hydroxy-5-methyl-phenyl)-propenone |