ethyl 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-2-methylpropionate
Modify Date: 2025-08-24 19:20:22
![ethyl 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-2-methylpropionate Structure](https://image.chemsrc.com/caspic/187/40674-21-3.png)
ethyl 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-2-methylpropionate structure
|
Common Name | ethyl 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-2-methylpropionate | ||
|---|---|---|---|---|
| CAS Number | 40674-21-3 | Molecular Weight | 277.27300 | |
| Density | 1.3g/cm3 | Boiling Point | 387.7ºC at 760mmHg | |
| Molecular Formula | C14H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.3ºC | |
| Name | ethyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 387.7ºC at 760mmHg |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.27300 |
| Flash Point | 188.3ºC |
| Exact Mass | 277.09500 |
| PSA | 72.91000 |
| LogP | 1.49380 |
| Index of Refraction | 1.567 |
| InChIKey | UNZUMKCIIIFEJI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)ON1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
|
~98%
ethyl 2-[(1,3-d... CAS#:40674-21-3 |
| Literature: AICURIS GMBH and CO. KG; KLENKE, Burkhard; WIEGAND, Irith; SCHIFFER, Guido; BROETZ-OESTERHELT, Heike; MAITI, Samarendra N.; KHAN, Jehangir; REDDY, Andhe; YANG, Zhixiang; HENA, Mostafa; JIA, Guofeng; LIGONG, Ou; LIANG, Hong; YIP, Judy; GAO, Chuanjun; TAJAMMUL, Sabiha; MOHAMMAD, Rahim; BISWAJEET, Ganguli Patent: WO2013/110643 A1, 2013 ; Location in patent: Paragraph 00275-0277 ; |
|
~32%
ethyl 2-[(1,3-d... CAS#:40674-21-3 |
| Literature: Bompart; Giral; Malicorne; Puygrenier European Journal of Medicinal Chemistry, 1988 , vol. 23, # 5 p. 457 - 464 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:5821-03-4| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Propanoic acid,2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-2-methyl-,ethyl ester |
| ETHYL 2-[(1,3-DIHYDRO-1,3-DIOXO-2H-ISOINDOL-2-YL)OXY]-2-METHYLPROPIONATE |
| 2-(Phthalimidooxy)-2,2-dimethylaceticacid ethyl ester |
| 2-(Phthalimido-oxy)-isobuttersaeureethylester |
| 2-(1,3-dioxo-1,3-dihydroisoindol-2-yloxy)-2-methylpropionic acid ethyl ester |
| EINECS 255-030-9 |
| 2-methyl-2-phthalimidooxy-propionic acid ethyl ester |