naphthalene-2,6-dicarbohydrazide structure
|
Common Name | naphthalene-2,6-dicarbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 4073-74-9 | Molecular Weight | 244.24900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalene-2,6-dicarbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N4O2 |
|---|---|
| Molecular Weight | 244.24900 |
| Exact Mass | 244.09600 |
| PSA | 110.24000 |
| LogP | 2.22920 |
| InChIKey | GNHGCDCAOUNOCA-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1ccc2cc(C(=O)NN)ccc2c1 |
| HS Code | 2928000090 |
|---|
|
~89%
naphthalene-2,6... CAS#:4073-74-9 |
| Literature: Ono, Katsuhiko; Ito, Hiroki; Nakashima, Akihiro; Uemoto, Mariko; Tomura, Masaaki; Saito, Katsuhiro Tetrahedron Letters, 2008 , vol. 49, # 40 p. 5816 - 5819 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,6-naphthalene dicarbohydrazide |
| 2,6-Naphthalenedicarboxylic acid,dihydrazide |