Naphthalene-2,6-disulfonic acid structure
|
Common Name | Naphthalene-2,6-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 581-75-9 | Molecular Weight | 288.29700 | |
| Density | 1.704 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalene-2,6-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.704 g/cm3 |
|---|---|
| Molecular Formula | C10H8O6S2 |
| Molecular Weight | 288.29700 |
| Exact Mass | 287.97600 |
| PSA | 125.50000 |
| LogP | 3.49480 |
| Index of Refraction | 1.695 |
| InChIKey | FITZJYAVATZPMJ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2cc(S(=O)(=O)O)ccc2c1 |
| RIDADR | UN 1759 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904100000 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| EINECS 209-471-9 |
| Naphthalene-2,6-bissulfonic acid |
| naphthalene-2,6-disulphonic acid |
| MFCD00065331 |
| 2,6-naphthale-disulfonic acid |
| 2,5-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE |
| Naphthalene-2,6-disulfonic acid |
| 2,6-NAPHTHALENE DISULFONIC ACID |
| 2,6-naphthalenedisulphonic acid |
| naphthalene-2,6-disulfonate |
| 2,6-naphthalenedisulfonate |
| Naphthalin-2,6-disulfonsaeure |