Naphthalene-2,6-disulfonic acid
Naphthalene-2,6-disulfonic acid structure
|
Common Name | Naphthalene-2,6-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 581-75-9 | Molecular Weight | 288.29700 | |
| Density | 1.704 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | naphthalene-2,6-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.704 g/cm3 |
|---|---|
| Molecular Formula | C10H8O6S2 |
| Molecular Weight | 288.29700 |
| Exact Mass | 287.97600 |
| PSA | 125.50000 |
| LogP | 3.49480 |
| Index of Refraction | 1.695 |
| InChIKey | FITZJYAVATZPMJ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2cc(S(=O)(=O)O)ccc2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| RIDADR | UN 1759 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904100000 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 9 | |
CAS#:92-41-1
CAS#:91-20-3
CAS#:120-18-3
CAS#:81-04-9
CAS#:1655-45-4
CAS#:6362-04-5
CAS#:7664-93-9
CAS#:525-37-1
CAS#:7732-18-5
CAS#:96892-95-4
CAS#:581-43-1
CAS#:93-01-6
CAS#:13827-62-8
CAS#:6483-80-3
CAS#:6654-67-7
CAS#:85-49-4
CAS#:6362-05-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 209-471-9 |
| Naphthalene-2,6-bissulfonic acid |
| naphthalene-2,6-disulphonic acid |
| MFCD00065331 |
| 2,6-naphthale-disulfonic acid |
| 2,5-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE |
| Naphthalene-2,6-disulfonic acid |
| 2,6-NAPHTHALENE DISULFONIC ACID |
| 2,6-naphthalenedisulphonic acid |
| naphthalene-2,6-disulfonate |
| 2,6-naphthalenedisulfonate |
| Naphthalin-2,6-disulfonsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of naphthalene-2,6-disulfonic acid? |
| A: CAS number of naphthalene-2,6-disulfonic acid is 581-75-9. |
| Q: What is the molecular formula of naphthalene-2,6-disulfonic acid? |
| A: Molecular formula of naphthalene-2,6-disulfonic acid is C10H8O6S2. |
| Q: What English synonyms does naphthalene-2,6-disulfonic acid have? |
| A: English synonyms of naphthalene-2,6-disulfonic acid: EINECS 209-471-9, Naphthalene-2,6-bissulfonic acid, naphthalene-2,6-disulphonic acid, MFCD00065331, 2,6-naphthale-disulfonic acid, 2,5-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE, Naphthalene-2,6-disulfonic acid, 2,6-NAPHTHALENE DISULFONIC ACID, 2,6-naphthalenedisulphonic acid, naphthalene-2,6-disulfonate, 2,6-naphthalenedisulfonate, Naphthalin-2,6-disulfonsaeure. |
| Q: What is the LogP of naphthalene-2,6-disulfonic acid? |
| A: LogP of naphthalene-2,6-disulfonic acid is 3.49480. |
| Q: What is the polar surface area (PSA) of naphthalene-2,6-disulfonic acid? |
| A: Polar surface area (PSA) of naphthalene-2,6-disulfonic acid is 125.50000. |
| Q: What is the InChIKey of naphthalene-2,6-disulfonic acid? |
| A: InChIKey of naphthalene-2,6-disulfonic acid is FITZJYAVATZPMJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of naphthalene-2,6-disulfonic acid? |
| A: Molecular weight of naphthalene-2,6-disulfonic acid is 288.29700. |
| Q: What are the upstream materials of naphthalene-2,6-disulfonic acid? |
| A: Related upstream materials(CAS) of naphthalene-2,6-disulfonic acid: 92-41-1;91-20-3;120-18-3;81-04-9;1655-45-4;6362-04-5;7664-93-9;525-37-1;7732-18-5. |
| Q: What is the SMILES notation of naphthalene-2,6-disulfonic acid? |
| A: SMILES notation of naphthalene-2,6-disulfonic acid is O=S(=O)(O)c1ccc2cc(S(=O)(=O)O)ccc2c1. |
| Q: What is the English name of naphthalene-2,6-disulfonic acid? |
| A: The English name of naphthalene-2,6-disulfonic acid is naphthalene-2,6-disulfonic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |