10-Methylisoalloxazine structure
|
Common Name | 10-Methylisoalloxazine | ||
|---|---|---|---|---|
| CAS Number | 4074-58-2 | Molecular Weight | 228.20700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-Methylisoalloxazine |
|---|
| Molecular Formula | C11H8N4O2 |
|---|---|
| Molecular Weight | 228.20700 |
| Exact Mass | 228.06500 |
| PSA | 80.90000 |
| LogP | 0.58230 |
| InChIKey | XJMWKAJCIMJIJK-UHFFFAOYSA-N |
| SMILES | Cn1c2nc(=O)[nH]c(=O)c-2nc2ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Reaction constant k1 value for the oxidation of the 1-benzyl-dihydronicotinamide in 1...
Source: ChEMBL
Target: N/A
External Id: CHEMBL845877
|
|
Name: Reaction constant k1 value for the oxidation of the 1-benzyl-dihydronicotinamide in 1...
Source: ChEMBL
Target: N/A
External Id: CHEMBL845876
|
|
Name: Antitumor activity against human CCRF-HSB2 cells by MTT assay
Source: ChEMBL
Target: CCRF-HSB-2
External Id: CHEMBL929830
|
|
Name: Antitumor activity against human KB cells by MTT assay
Source: ChEMBL
Target: KB
External Id: CHEMBL929831
|