DL-Aspartic Acid Dibenzyl Ester p-Toluenesulfonate structure
|
Common Name | DL-Aspartic Acid Dibenzyl Ester p-Toluenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 4079-62-3 | Molecular Weight | 485.549 | |
| Density | N/A | Boiling Point | 455.3ºC at 760 mmHg | |
| Molecular Formula | C25H27NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6ºC | |
Use of DL-Aspartic Acid Dibenzyl Ester p-ToluenesulfonateDibenzyl aspartate 4-methylbenzenesulfonate is an aspartic acid derivative[1]. |
| Name | [1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]azanium,4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Dibenzyl aspartate 4-methylbenzenesulfonate is an aspartic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 455.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.549 |
| Flash Point | 180.6ºC |
| Exact Mass | 485.150818 |
| PSA | 141.37000 |
| LogP | 5.21340 |
| InChIKey | HLMUYZYLPUHSNV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| HS Code | 2921199090 |
|---|
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| [1,4-bis(oxidanylidene)-1,4-bis(phenylmethoxy)butan-2-yl]azanium |
| Aspartic acid, bis(phenylmethyl) ester, 4-methylbenzenesulfonate (1:1) |
| dibenzyl-aspartate tosylate |
| aspartic acid dibenzyl ester p-toluenesulfonate |
| [1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]ammonium |
| 1,4-Bis(benzyloxy)-1,4-dioxobutan-2-aminium 4-methylbenzenesulfonate |
| D,L-Aspartic acid dibenzyl ester |
| D,L-Aspartic acid dibenzyl ester-p-toluenesulfonate |
| Dibenzyl aspartate 4-methylbenzenesulfonate (1:1) |
| DL-Aspartic Acid Dibenzyl Ester p-Toluenesulfonate |
| D,L-Asp(OBzl)-OBzl•TosOH |