methyl 4-(3-methylbutoxy)benzoate structure
|
Common Name | methyl 4-(3-methylbutoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 408340-71-6 | Molecular Weight | 222.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-(3-methylbutoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18O3 |
|---|---|
| Molecular Weight | 222.28000 |
| Exact Mass | 222.12600 |
| PSA | 35.53000 |
| LogP | 2.89810 |
| InChIKey | ULKCRLYLWOPDGY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OCCC(C)C)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Isopentyloxy-benzoesaeure-methylester |
| 4-Isoamyloxy-benzoesaeuremethylester |
| Methyl 4-(isopentyloxy)benzenecarboxylate |
| 4-isopentyloxy-benzoic acid methyl ester |
| methylisopentyloxybenzenecarboxylate |