(4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl acetate structure
|
Common Name | (4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 40870-69-7 | Molecular Weight | 208.21100 | |
| Density | 1.172g/cm3 | Boiling Point | 297.2ºC at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.4ºC | |
| Name | (4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 297.2ºC at 760 mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Flash Point | 128.4ºC |
| Exact Mass | 208.07400 |
| PSA | 60.44000 |
| LogP | 0.96410 |
| Index of Refraction | 1.5 |
| InChIKey | ZIJFBURUJALJSL-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=CC(=O)C(C)=C(C)C1=O |
|
~7%
Detail
|
| Literature: Nishino, Hiroshi; Nobuyuki, Itoh; Nagashima, Makiko; Kurosawa, Kazu Bulletin of the Chemical Society of Japan, 1992 , vol. 65, # 2 p. 620 - 622 |
|
~%
(4,5-dimethyl-3... CAS#:40870-69-7 |
| Literature: Lin; Cosby; Shansky; Sartorelli Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1247 - 1252 |
|
~%
(4,5-dimethyl-3... CAS#:40870-69-7 |
| Literature: Lin; Cosby; Shansky; Sartorelli Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1247 - 1252 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| p-Benzoquinone,2,3-dimethyl-5-(hydroxymethyl)-,acetate (ester) |
| 2,5-Cyclohexadiene-1,4-dione,5-((acetyloxy)methyl)-2,3-dimethyl |
| 2-acetoxymethyl-5,6-dimethyl-1,4-benzoquinone |
| 2,3-Dimethyl-5-(hydroxymethyl)-p-benzoquinone acetate (ester) |
| 2,3-Dimethyl-5-acetoxymethyl-p-benzoquinone |