3,3',5,5'-Tetra-tert-butyldiphenoquinone structure
|
Common Name | 3,3',5,5'-Tetra-tert-butyldiphenoquinone | ||
|---|---|---|---|---|
| CAS Number | 2455-14-3 | Molecular Weight | 408.61600 | |
| Density | 1.024 g/cm3 | Boiling Point | 492.6ºC at 760 mmHg | |
| Molecular Formula | C28H40O2 | Melting Point | 247-215ºC | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | 2,6-ditert-butyl-4-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.024 g/cm3 |
|---|---|
| Boiling Point | 492.6ºC at 760 mmHg |
| Melting Point | 247-215ºC |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.61600 |
| Flash Point | 182.4ºC |
| Exact Mass | 408.30300 |
| PSA | 34.14000 |
| LogP | 7.33840 |
| Vapour Pressure | 7.55E-10mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | GQIGHOCYKUBBOE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)C=C(C(C)(C)C)C1=O |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| 3,3',5,5'-TETRA-TERT-BUTYLDIPHENOQUINONE |
| 3,3',5,5'-Tetra-tert-butyl-4,4'-diphenoquinone |
| Probucol Related Compound A |
| 3,3',5,5'-tetra-tert-butyl-1,1'-bi(cyclohexa-2,5-dien-1-ylidene)-4,4'-dione |
| EINECS 219-527-4 |
| [Bi-2,5-cyclohexadien-1-ylidene]-4,4'-dione,3,3',5,5'-tetra-tert-butyl |
| 3,3',5,5'-tetra(tert-butyl)-[1,1'-bi-(cyclohexylidene)]-2,2',5,5'-tetraene-4,4'-dione |
| 3,3',5,5'-Tetra-tert-butyl-[1,1'-bi(cyclohexylidene)]-2,2',5,5'-tetraene-4,4'-dione |
| 3,3′,5,5′-Tetra-tert-butyldiphenoquinone |
| MFCD00051798 |