N-(1-benzamidoethyl)benzamide structure
|
Common Name | N-(1-benzamidoethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 40899-10-3 | Molecular Weight | 268.31000 | |
| Density | 1.159g/cm3 | Boiling Point | 563.1ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.8ºC | |
| Name | N-(1-benzamidoethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 563.1ºC at 760 mmHg |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.31000 |
| Flash Point | 224.8ºC |
| Exact Mass | 268.12100 |
| PSA | 58.20000 |
| LogP | 2.97420 |
| Index of Refraction | 1.586 |
| InChIKey | VNIZOKKZXNRUAO-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)c1ccccc1)NC(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-Aethyliden-bis-benzamid |
| 1,1-di(benzamido) ethane |
| Ethylen-bis-benzamid |
| N,N'-ethylidene-bis-benzamide |
| Aethylidenbisbenzamid |
| 1.1-Benzamino-ethan |
| N,N'-Dibenzoyl-1,1-diaminoethan |