1H,1'H-2,2'-Biindole structure
|
Common Name | 1H,1'H-2,2'-Biindole | ||
|---|---|---|---|---|
| CAS Number | 40899-99-8 | Molecular Weight | 232.28000 | |
| Density | 1.293g/cm3 | Boiling Point | 523.493ºC at 760 mmHg | |
| Molecular Formula | C16H12N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.058ºC | |
| Name | 2-(1H-indol-2-yl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 523.493ºC at 760 mmHg |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.28000 |
| Flash Point | 246.058ºC |
| Exact Mass | 232.10000 |
| PSA | 31.58000 |
| LogP | 4.31620 |
| Index of Refraction | 1.781 |
| InChIKey | FFBLFXFOMFDJLS-UHFFFAOYSA-N |
| SMILES | c1ccc2[nH]c(-c3cc4ccccc4[nH]3)cc2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2'-biindol |
| 2,2'-Bi-1H-indole |
| 2,2'-biindole |
| 2,2'-bisindole |
| 2,2'-bisindolyl |
| 2,2'-AZOBIS(2,4-DIMETHYLVALERONITRILE) |
| 1H,1'H-2,2'-biindole |
| 2,2'-Biindolyl |