K252C structure
|
Common Name | K252C | ||
|---|---|---|---|---|
| CAS Number | 85753-43-1 | Molecular Weight | 311.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H13N3O | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of K252CK-252c, a staurosporine analog isolated from Nocardiopsis sp., is a cell-permeable PKC inhibitor, with an IC50 of 2.45 µM. K-252c induces apoptosis in human chronic myelogenous leukemia cancer cells. K-252c also inhibits β-lactamase, chymotrypsin, and malate dehydrogenase[1][2][3]. |
| Name | K-252c,6,7,12,13-Tetrahydro-5H-indolo[2,3-a]pyrrolo[3,4-c]carbazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Description | K-252c, a staurosporine analog isolated from Nocardiopsis sp., is a cell-permeable PKC inhibitor, with an IC50 of 2.45 µM. K-252c induces apoptosis in human chronic myelogenous leukemia cancer cells. K-252c also inhibits β-lactamase, chymotrypsin, and malate dehydrogenase[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 2.45 µM (PKC)[1]. |
| References |
| Molecular Formula | C20H13N3O |
|---|---|
| Molecular Weight | 311.33700 |
| Exact Mass | 311.10600 |
| PSA | 60.68000 |
| LogP | 4.52780 |
| InChIKey | MEXUTNIFSHFQRG-UHFFFAOYSA-N |
| SMILES | O=C1NCc2c1c1c3ccccc3[nH]c1c1[nH]c3ccccc3c21 |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2933990090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| staurosporine aglycon |
| Staurosporinone,K-252c |
| Staurosporinone |
| K-252C |
| STAUROSPORINE AGLYCONE |