ethyl ester of N-trifluoroacetyl-L-tyrosine structure
|
Common Name | ethyl ester of N-trifluoroacetyl-L-tyrosine | ||
|---|---|---|---|---|
| CAS Number | 40908-40-5 | Molecular Weight | 305.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl ester of N-trifluoroacetyl-L-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14F3NO4 |
|---|---|
| Molecular Weight | 305.25000 |
| Exact Mass | 305.08700 |
| PSA | 75.63000 |
| LogP | 1.93580 |
| InChIKey | HHKUCFLBVWGKCJ-JTQLQIEISA-N |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)NC(=O)C(F)(F)F |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| N-trifluoroacetyl-L-tyrosine ethyl ester |
| N-trifluoroacetyl-L-tyrosine ethyl ester |
| N-Trifluoracetyl-L-tyrosin-aethylester |
| ethyl N-(trifluoroacetyl)-L-tyrosinate |
| N-TFAc-L-TyrOEt |