Methyl (R)-3-aMinobutyrate p-toluenesulfonate salt structure
|
Common Name | Methyl (R)-3-aMinobutyrate p-toluenesulfonate salt | ||
|---|---|---|---|---|
| CAS Number | 409081-18-1 | Molecular Weight | 289.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO5S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >100℃ | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | methyl (3R)-3-aminobutanoate,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19NO5S |
|---|---|
| Molecular Weight | 289.34800 |
| Flash Point | >100℃ |
| Exact Mass | 289.09800 |
| PSA | 115.07000 |
| LogP | 2.91950 |
| InChIKey | BGTUHDOWLHXQIA-FZSMXKCYSA-N |
| SMILES | COC(=O)CC(C)N.Cc1ccc(S(=O)(=O)O)cc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Hazard Codes | C |
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGIII |
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Methyl (R)-3-aminobutyrate p-toluenesulfonate salt |