2-[bis(4-methoxyphenyl)methylidene]butanedioic acid structure
|
Common Name | 2-[bis(4-methoxyphenyl)methylidene]butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 40938-16-7 | Molecular Weight | 342.34300 | |
| Density | 1.282g/cm3 | Boiling Point | 530.4ºC at 760 mmHg | |
| Molecular Formula | C19H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.8ºC | |
| Name | 2-[bis(4-methoxyphenyl)methylidene]butanedioic acid |
|---|
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 530.4ºC at 760 mmHg |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.34300 |
| Flash Point | 189.8ºC |
| Exact Mass | 342.11000 |
| PSA | 93.06000 |
| LogP | 3.06500 |
| Index of Refraction | 1.595 |
| InChIKey | BZWJGTNNWTUEAP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=C(CC(=O)O)C(=O)O)c2ccc(OC)cc2)cc1 |
|
~%
2-[bis(4-methox... CAS#:40938-16-7 |
| Literature: Baddar et al. Journal of the Chemical Society, 1955 , p. 1714,1717 |
|
~%
2-[bis(4-methox... CAS#:40938-16-7 |
| Literature: Klemm; Lind Journal of Organic Chemistry, 1956 , vol. 21, p. 258 |
|
~%
2-[bis(4-methox... CAS#:40938-16-7 |
| Literature: Baddar et al. Journal of the Chemical Society, 1955 , p. 1714,1717 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |