4-[(4-Amino-5-methoxy-2-methylphenyl)azo]benzenesulfonic acid structure
|
Common Name | 4-[(4-Amino-5-methoxy-2-methylphenyl)azo]benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 40947-69-1 | Molecular Weight | 321.352 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-Amino-5-methoxy-2-methylphenyl)azo]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.352 |
| Exact Mass | 321.078339 |
| PSA | 122.72000 |
| LogP | 2.94 |
| Index of Refraction | 1.630 |
| InChIKey | RFHAPRIQUZZKDJ-UHFFFAOYSA-N |
| SMILES | COc1cc(N=Nc2ccc(S(=O)(=O)O)cc2)c(C)cc1N |
| HS Code | 2927000090 |
|---|
|
~%
4-[(4-Amino-5-m... CAS#:40947-69-1 |
| Literature: MITSUBISHI CHEMICAL CORPORATION Patent: EP1679350 A1, 2006 ; Location in patent: Page/Page column 41 ; |
|
~%
4-[(4-Amino-5-m... CAS#:40947-69-1 |
| Literature: Sebe, Ion; Tarabasanu-Mihaila, Cornel Revue Roumaine de Chimie, 1995 , vol. 40, # 3 p. 275 - 286 |
|
~%
4-[(4-Amino-5-m... CAS#:40947-69-1 |
| Literature: Sebe, Ion; Tarabasanu-Mihaila, Cornel Revue Roumaine de Chimie, 1995 , vol. 40, # 3 p. 275 - 286 |
|
~%
4-[(4-Amino-5-m... CAS#:40947-69-1 |
| Literature: Kobayashi et al. Bulletin of the Chemical Society of Japan, 1959 , vol. 32, p. 681 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(4-amino-5-methoxy-2-methyl-phenylazo)-benzenesulfonic acid |
| 2-Methoxy-5-methyl-4-[(4-sulfophenyl)azo]benzenamine |
| Benzenesulfonic acid, 4-((4-amino-5-methoxy-2-methylphenyl)azo)-, |
| 4-(4-Amino-5-methoxy-2-methyl-phenylazo)-benzolsulfonsaeure |
| Benzenesulfonic acid, 4-[(E)-2-(4-amino-5-methoxy-2-methylphenyl)diazenyl]- |
| sulfanilic acid cresidine |
| 4-[(4-Amino-5-methox |
| 2-methoxy-5-methyl-4-(4-sulfophenylazo)aniline |
| 4-[(E)-(4-Amino-5-methoxy-2-methylphenyl)diazenyl]benzenesulfonic acid |
| p-[(4-amino-5-methoxy-o-tolyl)azo]benzenesulphonic acid |
| p-[(4-amino-5-methoxy-o-tolyl)azo]benzenesulfonic acid |