Trimethyl 1,1,2-ethanetricarboxylate structure
|
Common Name | Trimethyl 1,1,2-ethanetricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 40967-67-7 | Molecular Weight | 204.177 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 247.7±20.0 °C at 760 mmHg | |
| Molecular Formula | C8H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.2±21.8 °C | |
| Name | Trimethyl ethane-1,1,2-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 247.7±20.0 °C at 760 mmHg |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.177 |
| Flash Point | 102.2±21.8 °C |
| Exact Mass | 204.063385 |
| PSA | 78.90000 |
| LogP | 0.08 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.431 |
| InChIKey | CFXNPIZDNPUMFS-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C(=O)OC)C(=O)OC |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917190090 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Trimethyl 1,1,2-ethanetricarboxylate |
| 1,1,2-Ethanetricarboxylic acid, trimethyl ester |
| Trimethyl ethane-1,1,2-tricarboxylate |
| 2-Methoxycarbonyl-succinic acid dimethyl ester |
| 2-methoxycarbonylsuccinic acid dimethyl ester |
| Trimethyl 1,1,2-ethane tricarboxylate |