3-(2-amino-1-hydroxyethyl)-1H-indol-5-ol structure
|
Common Name | 3-(2-amino-1-hydroxyethyl)-1H-indol-5-ol | ||
|---|---|---|---|---|
| CAS Number | 40979-78-0 | Molecular Weight | 192.21400 | |
| Density | 1.423g/cm3 | Boiling Point | 512.4ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7ºC | |
| Name | 3-(2-amino-1-hydroxyethyl)-1H-indol-5-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.423g/cm3 |
|---|---|
| Boiling Point | 512.4ºC at 760 mmHg |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.21400 |
| Flash Point | 263.7ºC |
| Exact Mass | 192.09000 |
| PSA | 82.27000 |
| LogP | 1.56590 |
| Index of Refraction | 1.75 |
| InChIKey | QVOWFHFJMYNTKY-UHFFFAOYSA-N |
| SMILES | NCC(O)c1c[nH]c2ccc(O)cc12 |
| HS Code | 2933990090 |
|---|
|
~%
3-(2-amino-1-hy... CAS#:40979-78-0 |
| Literature: Ames et al. Journal of the Chemical Society, 1956 , p. 1984,1988 |
|
~%
3-(2-amino-1-hy... CAS#:40979-78-0 |
| Literature: Ames et al. Journal of the Chemical Society, 1956 , p. 1984,1988 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-Amino-1-hydroxy-aethyl)-indol-5-ol |
| 3-(2-amino-1-hydroxy-ethyl)-indol-5-ol |