5-Benzyloxyindole structure
|
Common Name | 5-Benzyloxyindole | ||
|---|---|---|---|---|
| CAS Number | 1215-59-4 | Molecular Weight | 223.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 411.6±20.0 °C at 760 mmHg | |
| Molecular Formula | C15H13NO | Melting Point | 100-104 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 148.9±12.0 °C | |
| Name | 5-Benzyloxyindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.6±20.0 °C at 760 mmHg |
| Melting Point | 100-104 °C(lit.) |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.270 |
| Flash Point | 148.9±12.0 °C |
| Exact Mass | 223.099716 |
| PSA | 25.02000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.670 |
| InChIKey | JCQLPDZCNSVBMS-UHFFFAOYSA-N |
| SMILES | c1ccc(COc2ccc3[nH]ccc3c2)cc1 |
| Storage condition | 2-8°C |
| Water Solubility | ethanol: may be hazy yellow |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi:Irritant |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S24/25-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | NL4850000 |
| HS Code | 2933990090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
5-benzyloxytryptamine as an antagonist of TRPM8.
Bioorg. Med. Chem. Lett. 20 , 7076-9, (2010) 5-Benzyloxytryptamine 19 was found to act as an antagonist of the TRPM8 ion-channel. For example, 19 had an IC(50) of 0.34 μM when menthol was used as the stimulating agonist. Related commercially-ava... |
| 5-Benzyloxyindole |
| 1H-Indole, 5- (phenylmethoxy)- |
| 5-(Benzyloxy)indole |
| 1H-Indole, 5-(phenylmethoxy)- |
| 5-Benzyindole |
| Indole, 5- (benzyloxy)- |
| 5-benzyloxy-indol |
| Benzyloxy-5 indole |
| 5-phenylmethoxyindole |
| bredreck's |
| EINECS 214-930-1 |
| 5-(Benzyloxy)-1H-indole |
| 5-phenylmethoxy-1H-indole |
| 5-BnO-indole |
| 5-BENZYLOXY-1H-INDOLE |
| MFCD00005676 |