3,4,6-Tri-O-acetyl-D-galactal structure
|
Common Name | 3,4,6-Tri-O-acetyl-D-galactal | ||
|---|---|---|---|---|
| CAS Number | 4098-06-0 | Molecular Weight | 272.251 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 343.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H16O7 | Melting Point | 34-38 °C(lit.) | |
| MSDS | N/A | Flash Point | 149.2±27.9 °C | |
| Name | Tri-O-acetyl-D-galactal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.1±42.0 °C at 760 mmHg |
| Melting Point | 34-38 °C(lit.) |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.251 |
| Flash Point | 149.2±27.9 °C |
| Exact Mass | 272.089600 |
| PSA | 88.13000 |
| LogP | 0.36 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | LLPWGHLVUPBSLP-IJLUTSLNSA-N |
| SMILES | CC(=O)OCC1OC=CC(OC(C)=O)C1OC(C)=O |
| Storage condition | Refrigerator (+4°C) |
| Water Solubility | Insoluble |
| Hazard Codes | C |
|---|---|
| Safety Phrases | S23-S24/25 |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4,6-Tri-O-acetyl-D-galactal |
| [(2R,3R,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| EINECS 223-859-5 |
| 1,5-Anhydro-2-deoxy-D-lyxo-hex-1-enitol 3,4,6-Tri-O-acetyl Ether |
| D-arabino-Hex-5-enitol, 2,6-anhydro-5-deoxy-, triacetate |
| Hex-5-enitol, 2,6-anhydro-5-deoxy-, triacetate |
| 1,2-Dideoxy-3,4,6-tri-O-acetyl-D-lyxo-1-hexenopyranose |
| Tri-O-acetyl-D-galactal |
| 2,6-Anhydro-5-deoxy-D-arabino-hex-5-enitol triacetate hexenopyranose |
| (2R,3R,4R)-2-(acetoxymethyl)-3,4-dihydro-2H-pyran-3,4-diyl diacetate |
| 1,3,4-Tri-O-acetyl-2,6-anhydro-5-deoxy-D-arabino-hex-5-enitol |
| MFCD00064092 |