1,1,2,2-Tetrafluoro-1,2-bis(4-fluorophenyl)ethane structure
|
Common Name | 1,1,2,2-Tetrafluoro-1,2-bis(4-fluorophenyl)ethane | ||
|---|---|---|---|---|
| CAS Number | 4100-99-6 | Molecular Weight | 290.20400 | |
| Density | 1.35g/cm3 | Boiling Point | 255.3ºC at 760 mmHg | |
| Molecular Formula | C14H8F6 | Melting Point | 96-97ºC | |
| MSDS | N/A | Flash Point | 85.4ºC | |
| Name | 1,1,2,2-Tetrafluoro-1,2-bis(4-fluorophenyl)ethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 255.3ºC at 760 mmHg |
| Melting Point | 96-97ºC |
| Molecular Formula | C14H8F6 |
| Molecular Weight | 290.20400 |
| Flash Point | 85.4ºC |
| Exact Mass | 290.05300 |
| LogP | 4.84860 |
| Index of Refraction | 1.471 |
| InChIKey | OCIWSXHEGSCIOO-UHFFFAOYSA-N |
| SMILES | Fc1ccc(C(F)(F)C(F)(F)c2ccc(F)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903999090 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-fluoro-4-[1,1,2,2-tetrafluoro-2-(4-fluorophenyl)ethyl]benzene |