1-(4,5-Dimethoxy-2-nitrophenyl)ethanone structure
|
Common Name | 1-(4,5-Dimethoxy-2-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 4101-32-0 | Molecular Weight | 225.198 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 389.2±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5±28.5 °C | |
| Name | 1-(4,5-dimethoxy-2-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.2±37.0 °C at 760 mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.198 |
| Flash Point | 184.5±28.5 °C |
| Exact Mass | 225.063721 |
| PSA | 81.35000 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | ZVLFGESHYMKNQP-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)=O)c([N+](=O)[O-])cc1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4,5-Dimethoxy-2-nitrophenyl)ethanone |
| 1-(4,5-DIMETHOXY-2-NITRO-PHENYL)-ETHANONE |
| 2'-nitro-4',5'-dimethoxyacetophenone |
| 4,5-dimethoxy-2-nitroacetophenone |
| Ethanone, 1-(4,5-dimethoxy-2-nitrophenyl)- |
| 3,4-dimethoxy-6-nitroacetophenone |