2-Iodo-1,3-dimethyl-4-nitrobenzene structure
|
Common Name | 2-Iodo-1,3-dimethyl-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 4102-46-9 | Molecular Weight | 277.05900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-iodo-1,3-dimethyl-4-nitro-benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8INO2 |
|---|---|
| Molecular Weight | 277.05900 |
| Exact Mass | 276.96000 |
| PSA | 45.82000 |
| LogP | 3.33940 |
| InChIKey | WBYYSBBIRPABFU-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(C)c1I |
|
~%
2-Iodo-1,3-dime... CAS#:4102-46-9 |
| Literature: Suzuki,H. et al. Bulletin of the Chemical Society of Japan, 1965 , vol. 38, p. 1590 - 1595 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-Iodo-4-methyl-1,3,5-trineopentylbenzene |
| 2-Iod-4-methyl-1,3,5-trineopentylbenzol |
| Benzene,1,3,5-tris(2,2-dimethylpropyl)-2-iodo-4-methyl |
| 2-Iod-4-nitro-m-xylol |