1H-Imidazole-5-methanol,a-[2-(1,3-dioxolan-2-yl)ethyl]-2-methyl-1-(phenylmethyl)- structure
|
Common Name | 1H-Imidazole-5-methanol,a-[2-(1,3-dioxolan-2-yl)ethyl]-2-methyl-1-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 41030-01-7 | Molecular Weight | 302.36800 | |
| Density | 1.23g/cm3 | Boiling Point | 487.6ºC at 760 mmHg | |
| Molecular Formula | C17H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.7ºC | |
| Name | 1-(3-benzyl-2-methylimidazol-4-yl)-3-(1,3-dioxolan-2-yl)propan-1-ol |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 487.6ºC at 760 mmHg |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.36800 |
| Flash Point | 248.7ºC |
| Exact Mass | 302.16300 |
| PSA | 56.51000 |
| LogP | 2.42630 |
| Index of Refraction | 1.597 |
| InChIKey | CIFQMGSCMGACKJ-UHFFFAOYSA-N |
| SMILES | Cc1ncc(C(O)CCC2OCCO2)n1Cc1ccccc1 |
|
~%
1H-Imidazole-5-... CAS#:41030-01-7 |
| Literature: Loozen,H.J.J. et al. Journal of Organic Chemistry, 1975 , vol. 40, p. 892 - 894 |
|
~%
1H-Imidazole-5-... CAS#:41030-01-7 |
| Literature: Loozen,H.J.J.; Godefroi,E.F. Journal of Organic Chemistry, 1973 , vol. 38, # 20 p. 3495 - 3497 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |