lipiferolide structure
|
Common Name | lipiferolide | ||
|---|---|---|---|---|
| CAS Number | 41059-80-7 | Molecular Weight | 306.35 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 444.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H22O5 | Melting Point | 118-119 °C | |
| MSDS | N/A | Flash Point | 196.3±28.8 °C | |
Use of lipiferolideLipiferolide is an antiplasmodial agent (IC50: 1.8 μg/mL) that can be isolated from Liriodendron tulipifera. Lipiferolide also inhibits FPTase, and has antitumor activity[1][2]. |
| Name | 8.β.-Acetoxy-parthenolide |
|---|---|
| Synonym | More Synonyms |
| Description | Lipiferolide is an antiplasmodial agent (IC50: 1.8 μg/mL) that can be isolated from Liriodendron tulipifera. Lipiferolide also inhibits FPTase, and has antitumor activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.8±45.0 °C at 760 mmHg |
| Melting Point | 118-119 °C |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.35 |
| Flash Point | 196.3±28.8 °C |
| Exact Mass | 306.146729 |
| PSA | 65.13000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | ODYJJNFWFYUXSS-WJLJLRDOSA-N |
| SMILES | C=C1C(=O)OC2C1C(OC(C)=O)CC(C)=CCCC1(C)OC21 |
| Oxireno[9,10]cyclodeca[1,2-b]furan-9(1aH)-one, 7-(acetyloxy)-2,3,6,7,7a,8,10a,10b-octahydro-1a,5-dimethyl-8-methylene-, (1aR,4E,7R,7aR,10aS,10bR)- |
| (1aR,4E,7R,7aR,10aS)-1a,5-Dimethyl-8-methylene-9-oxo-1a,2,3,6,7,7a,8,9,10a,10b-decahydrooxireno[9,10]cyclodeca[1,2-b]furan-7-yl acetate |
| Lipiferolide |
| Oxireno[9,10]cyclodeca[1,2-b]furan-9(1aH)-one, 7-(acetyloxy)-2,3,6,7,7a,8,10a,10b-octahydro-1a,5-dimethyl-8-methylene-, (1aR,4E,7R,7aR,10aS)- |
| 8.beta.-Acetoxy-parthenolide |
| Lipiferolid |
| (1aR,4E,7R,7aR,10aS,10bR)-1a,5-Dimethyl-8-methylene-9-oxo-1a,2,3,6,7,7a,8,9,10a,10b-decahydrooxireno[9,10]cyclodeca[1,2-b]furan-7-yl acetate |