2-[(2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide structure
|
Common Name | 2-[(2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 4106-67-6 | Molecular Weight | 326.30700 | |
| Density | 1.32 | Boiling Point | 525.3ºC at 760 mmHg | |
| Molecular Formula | C16H14N4O4 | Melting Point | 225ºC | |
| MSDS | N/A | Flash Point | 271.5ºC | |
| Name | 2-[(2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 |
|---|---|
| Boiling Point | 525.3ºC at 760 mmHg |
| Melting Point | 225ºC |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.30700 |
| Flash Point | 271.5ºC |
| Exact Mass | 326.10200 |
| PSA | 116.71000 |
| LogP | 3.87100 |
| Index of Refraction | 1.628 |
| InChIKey | FCUWHABSNJYYDW-UHFFFAOYSA-N |
| SMILES | CC(=O)C(N=Nc1ccccc1[N+](=O)[O-])C(=O)Nc1ccccc1 |
| HS Code | 2927000090 |
|---|
|
~%
2-[(2-nitrophen... CAS#:4106-67-6 |
| Literature: Jain; Dixit; Pandey Journal of the Indian Chemical Society, 1989 , vol. 66, # 7 p. 486 - 489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 223-884-1 |
| 2-[(o-nitrophenyl)azo]acetoacetanilide |
| Butanamide,2-((2-nitrophenyl)azo)-3-oxo-N-phenyl |
| O868 |
| 2-[(e)-(2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide |