2-[4-(4-fluorophenoxy)phenyl]acetic acid structure
|
Common Name | 2-[4-(4-fluorophenoxy)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 41073-15-8 | Molecular Weight | 246.23400 | |
| Density | 1.284g/cm3 | Boiling Point | 379.5ºC at 760 mmHg | |
| Molecular Formula | C14H11FO3 | Melting Point | 97-101ºC | |
| MSDS | Chinese USA | Flash Point | 183.3ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 2-[4-(4-fluorophenoxy)phenyl]acetic acid |
|---|
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 379.5ºC at 760 mmHg |
| Melting Point | 97-101ºC |
| Molecular Formula | C14H11FO3 |
| Molecular Weight | 246.23400 |
| Flash Point | 183.3ºC |
| Exact Mass | 246.06900 |
| PSA | 46.53000 |
| LogP | 3.24510 |
| Index of Refraction | 1.58 |
| InChIKey | VMMSFFIABDLZIP-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc(Oc2ccc(F)cc2)cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H400 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,N |
| Risk Phrases | 22-36/37/38-50 |
| Safety Phrases | 26-61 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2918990090 |
|
~86%
2-[4-(4-fluorop... CAS#:41073-15-8 |
| Literature: Eli Lilly and Company Patent: US6353128 B1, 2002 ; Location in patent: Page column 13 ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |