ethyl 2-(4-phenylcyclohexyl)acetate
Modify Date: 2025-08-23 18:07:54
ethyl 2-(4-phenylcyclohexyl)acetate structure
|
Common Name | ethyl 2-(4-phenylcyclohexyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 411238-92-1 | Molecular Weight | 246.34500 | |
| Density | 1.006g/cm3 | Boiling Point | 338.9ºC at 760 mmHg | |
| Molecular Formula | C16H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.3ºC | |
| Name | ethyl 2-(4-phenylcyclohexyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.006g/cm3 |
|---|---|
| Boiling Point | 338.9ºC at 760 mmHg |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.34500 |
| Flash Point | 123.3ºC |
| Exact Mass | 246.16200 |
| PSA | 26.30000 |
| LogP | 3.91360 |
| Index of Refraction | 1.504 |
| InChIKey | NQKKTEIOHKETAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CCC(c2ccccc2)CC1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Cyclohexaneacetic acid,4-phenyl-,ethyl ester |
| (4-Phenyl-cyclohexyl)-acetic acid ethyl ester |
| ethyl-2-(4-phenylcyclohexyl)acetate |
| Y5861 |
| Ethyl 2-((1R,4R)-4-phenylcyclohexyl)acetate |