5-Hydroxyplatyphyllone M structure
|
Common Name | 5-Hydroxyplatyphyllone M | ||
|---|---|---|---|---|
| CAS Number | 41137-85-3 | Molecular Weight | 314.376 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 575.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.7±26.6 °C | |
Use of 5-Hydroxyplatyphyllone MPlatyphyllonol (Platyphyllone) can be isolated from A. japonica. Platyphyllonol shows cytotoxic effects on MCF-7 cells with IC50 values of 46.9 μg/mL[1]. |
| Name | (5S)-5-Hydroxy-1,7-bis(4-hydroxyphenyl)-3-heptanone |
|---|---|
| Synonym | More Synonyms |
| Description | Platyphyllonol (Platyphyllone) can be isolated from A. japonica. Platyphyllonol shows cytotoxic effects on MCF-7 cells with IC50 values of 46.9 μg/mL[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.2±50.0 °C at 760 mmHg |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.376 |
| Flash Point | 315.7±26.6 °C |
| Exact Mass | 314.151794 |
| PSA | 77.76000 |
| LogP | 2.08 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | ZBFSUZGUYFFWGY-GOSISDBHSA-N |
| SMILES | O=C(CCc1ccc(O)cc1)CC(O)CCc1ccc(O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914501900 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3-Heptanone, 5-hydroxy-1,7-bis(4-hydroxyphenyl)-, (5S)- |
| hirsutanonol |
| 5-Hydroxy-3-platyphyllone |
| 7,7-diphenyl-4,5,6,6a-tetrahydro-1H,3H-pyrrolo<1,2-c>oxazol-2-one |
| (5S)-5-Hydroxy-1,7-bis(4-hydroxyphenyl)-3-heptanone |