N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1-phenylmethanimine structure
|
Common Name | N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1-phenylmethanimine | ||
|---|---|---|---|---|
| CAS Number | 4116-06-7 | Molecular Weight | 255.33000 | |
| Density | 0.98g/cm3 | Boiling Point | 135ºC 0,3mm | |
| Molecular Formula | C17H18FN | Melting Point | 43-45ºC | |
| MSDS | N/A | Flash Point | 170.7ºC | |
| Name | N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1-phenylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 135ºC 0,3mm |
| Melting Point | 43-45ºC |
| Molecular Formula | C17H18FN |
| Molecular Weight | 255.33000 |
| Flash Point | 170.7ºC |
| Exact Mass | 255.14200 |
| PSA | 12.36000 |
| LogP | 4.26590 |
| Index of Refraction | 1.517 |
| InChIKey | HPAANHNPBCGDLR-UHFFFAOYSA-N |
| SMILES | CC(C)(Cc1ccc(F)cc1)N=Cc1ccccc1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (1E)-4-(4-fluorophenyl)-3,3-dimethyl-1-phenyl-2-azabut-1-ene |
| MFCD00151999 |
| N-Benzylidene-1,1-dimethyl-2-(4-fluorophenyl)ethylamine |