ethyl 6-(4-bromophenyl)-6-oxohexanoate structure
|
Common Name | ethyl 6-(4-bromophenyl)-6-oxohexanoate | ||
|---|---|---|---|---|
| CAS Number | 412022-61-8 | Molecular Weight | 313.18700 | |
| Density | 1.306g/cm3 | Boiling Point | 394.3ºC at 760 mmHg | |
| Molecular Formula | C14H17BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.3ºC | |
| Name | ethyl 6-(4-bromophenyl)-6-oxohexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 394.3ºC at 760 mmHg |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.18700 |
| Flash Point | 192.3ºC |
| Exact Mass | 312.03600 |
| PSA | 43.37000 |
| LogP | 3.75530 |
| Index of Refraction | 1.525 |
| InChIKey | XBAUTCKEBKXFEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCC(=O)c1ccc(Br)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
ethyl 6-(4-brom... CAS#:412022-61-8 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-(4-bromo-phenyl)-6-oxo-hexanoic acid ethyl ester |
| 6-(4-Brom-phenyl)-6-oxo-hexansaeure-aethylester |