1,4,8,11-tetramethyl-1,4,8,11-tetraazacyclotetradecane structure
|
Common Name | 1,4,8,11-tetramethyl-1,4,8,11-tetraazacyclotetradecane | ||
|---|---|---|---|---|
| CAS Number | 41203-22-9 | Molecular Weight | 256.43100 | |
| Density | 0.876 g/cm3 | Boiling Point | >230 °F | |
| Molecular Formula | C14H32N4 | Melting Point | 38-42 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,4,8,11-tetramethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.876 g/cm3 |
|---|---|
| Boiling Point | >230 °F |
| Melting Point | 38-42 °C(lit.) |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.43100 |
| Flash Point | >230 °F |
| Exact Mass | 256.26300 |
| PSA | 12.96000 |
| LogP | 0.25900 |
| InChIKey | HRFJEOWVAGSJNW-UHFFFAOYSA-N |
| SMILES | CN1CCCN(C)CCN(C)CCCN(C)CC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~%
1,4,8,11-tetram... CAS#:41203-22-9 |
| Literature: Murphy, Michael A; Malachowski, Mitchell R Patent: US2005/85555 A1, 2005 ; US 20050085555 A1 |
|
~10%
1,4,8,11-tetram... CAS#:41203-22-9 |
| Literature: Jurczak, Janusz; Ostaszewski, Ryszard Tetrahedron Letters, 1988 , vol. 29, # 8 p. 959 - 960 |
|
~%
1,4,8,11-tetram... CAS#:41203-22-9 |
| Literature: Royal, Guy; Dahaoui-Gindrey, Valerie; Dahaoui, Slimane; Tabard, Alain; Guilard, Roger; Pullumbi, Pluton; Lecomte, Claude European Journal of Organic Chemistry, 1998 , # 9 p. 1971 - 1975 |
|
~%
1,4,8,11-tetram... CAS#:41203-22-9 |
| Literature: Evangelio, Emi; Rath, Nigam P.; Mirica, Liviu M. Dalton Transactions, 2012 , vol. 41, # 26 p. 8010 - 8021 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4,7,11-tetramethyl-1,4,7,11-tetraazacyclotetradecane |
| 1,4,8,11-tetraaza-1,4,8,11-tetramethylcyclotetradecane |
| 1,4,8,11-tetramethyl-1,4,8,11-tetra-azacyclotetradecane |
| 1,4,8,11-Tetraazacyclotetradecane,1,4,8,11-tetramethyl |
| MFCD00005106 |
| 1,4,8,11-Tetramethylcyclam |