1-(4-chloro-3-trifluoromethylphenyl)piperazine structure
|
Common Name | 1-(4-chloro-3-trifluoromethylphenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 41213-04-1 | Molecular Weight | 264.67500 | |
| Density | 1.302g/cm3 | Boiling Point | 357.3ºC at 760mmHg | |
| Molecular Formula | C11H12ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.9ºC | |
| Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 357.3ºC at 760mmHg |
| Molecular Formula | C11H12ClF3N2 |
| Molecular Weight | 264.67500 |
| Flash Point | 169.9ºC |
| Exact Mass | 264.06400 |
| PSA | 15.27000 |
| LogP | 3.16220 |
| Index of Refraction | 1.499 |
| InChIKey | SOVLQDJRXJFKHO-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(N2CCNCC2)ccc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933599090 |
|
~%
1-(4-chloro-3-t... CAS#:41213-04-1 |
| Literature: Sonesson, Clas; Andersson, Bengt; Waters, Susanna; Waters, Nicholas; Tedroff, Joakim Patent: US2003/4169 A1, 2003 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| [4-chloro-3-(trifluoromethyl)phenyl]piperazine |
| 1-(4-Chlor-3-trifluormethylphenyl)piperazin |
| 1-(4-chloro-3-trifluoromethylphenyl)piperazine |
| 1-(3-trifluorometyl-4-chlorophenyl)piperazine |
| MFCD00040735 |
| EINECS 255-267-8 |
| 1-<p-Chlor-m-(trifluormethyl)phenyl>piperazin |
| 4-(4-chloro-3trifluoromethylphenyl)piperazine |