1-Iodo-3-nitro-5-(trifluoromethyl)benzene structure
|
Common Name | 1-Iodo-3-nitro-5-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 41253-01-4 | Molecular Weight | 317.004 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 264.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H3F3INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.7±25.9 °C | |
| Name | 1-iodo-3-nitro-5-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 264.3±35.0 °C at 760 mmHg |
| Molecular Formula | C7H3F3INO2 |
| Molecular Weight | 317.004 |
| Flash Point | 113.7±25.9 °C |
| Exact Mass | 316.916046 |
| PSA | 45.82000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | BANTUHUNKDGMCA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(I)cc(C(F)(F)F)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2904909090 |
|
~21%
1-Iodo-3-nitro-... CAS#:41253-01-4 |
| Literature: Tokunaga; Hume; Umezome; Okazaki; Ueki; Kumagai; Hourai; Nagamine; Seki; Taiji; Noguchi; Nagata Journal of Medicinal Chemistry, 2001 , vol. 44, # 26 p. 4641 - 4649 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-Nitro-5-iodobenzotrifluoride |
| 1-Iodo-3-nitro-5-(trifluoromethyl)benzene |
| 5-Iodo-3-nitro-1-trifluoromethylbenzene |
| 3-Iodo-5-nitrobenzotrifluoride |
| 3-Nitro-5-jodobenzotrifluorid |