6-bromo-2-(4-methylphenyl)chromen-4-one structure
|
Common Name | 6-bromo-2-(4-methylphenyl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 41255-32-7 | Molecular Weight | 315.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-bromo-2-(4-methylphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11BrO2 |
|---|---|
| Molecular Weight | 315.16100 |
| Exact Mass | 313.99400 |
| PSA | 30.21000 |
| LogP | 4.53090 |
| InChIKey | XSBPYQNXBLNZCI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cc(=O)c3cc(Br)ccc3o2)cc1 |
|
~%
6-bromo-2-(4-me... CAS#:41255-32-7 |
| Literature: Bhagwat; Wheeler Journal of the Chemical Society, 1939 , p. 94 |
|
~%
6-bromo-2-(4-me... CAS#:41255-32-7 |
| Literature: Bhagwat; Wheeler Journal of the Chemical Society, 1939 , p. 94 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-bromo-2-p-tolyl-chromen-4-one |
| 6-Brom-2-p-tolyl-chromen-4-on |
| F3139-0616 |
| 6-BROMO-4'-METHYLFLAVONE |