4-(Methylamino)-3-nitrobenzoic acid structure
|
Common Name | 4-(Methylamino)-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 41263-74-5 | Molecular Weight | 196.160 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 393.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | >300ºC | |
| MSDS | N/A | Flash Point | 191.9±26.5 °C | |
| Name | 4-(Methylamino)-3-Nitrobenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 393.7±37.0 °C at 760 mmHg |
| Melting Point | >300ºC |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.160 |
| Flash Point | 191.9±26.5 °C |
| Exact Mass | 196.048401 |
| PSA | 95.15000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | KSMLIIWEQBYUKA-UHFFFAOYSA-N |
| SMILES | CNc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| Storage condition | Refrigerator, Under Inert Atmosphere |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Name: Agonist activity at human GPR109b receptor transfected in CHOK1 cells assessed as rev...
Source: ChEMBL
Target: Hydroxycarboxylic acid receptor 3
External Id: CHEMBL899918
|
|
Name: Agonist activity at human GPR109a receptor transfected in CHOK1 cells at 30 uM assess...
Source: ChEMBL
Target: Hydroxycarboxylic acid receptor 2
External Id: CHEMBL899919
|
| WNR CVQ FM1 |
| 4-(Methylamino)-3-nitrobenzoic acid |
| 4-Aminomethyl-3-Nitrobenzoic Acid |