Ethyl 2-(4-isobutylphenyl)propanoate structure
|
Common Name | Ethyl 2-(4-isobutylphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 41283-72-1 | Molecular Weight | 234.33400 | |
| Density | 0.967g/cm3 | Boiling Point | 304.3ºC at 760 mmHg | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.1ºC | |
| Name | ethyl 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.967g/cm3 |
|---|---|
| Boiling Point | 304.3ºC at 760 mmHg |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33400 |
| Flash Point | 103.1ºC |
| Exact Mass | 234.16200 |
| PSA | 26.30000 |
| LogP | 3.55170 |
| Index of Refraction | 1.491 |
| InChIKey | HXTFUVWJFLDLJP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)c1ccc(CC(C)C)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| ethyl 2-(4-isobutylphenyl)-propanoate |
| EINECS 255-291-9 |
| 2-(4-isobutylphenyl)-propionic acid ethyl ester |
| Hydratropic acid,p-isobutyl-,ethyl ester |
| ethyl 2-(4-isobutyl-phenyl)-propionate |
| Ibuprofen ethyl ester |