2-Silyl-1,1,2-ethenetriyl triacetate structure
|
Common Name | 2-Silyl-1,1,2-ethenetriyl triacetate | ||
|---|---|---|---|---|
| CAS Number | 4130-08-9 | Molecular Weight | 232.263 | |
| Density | 1.167 g/mL at 25 °C(lit.) | Boiling Point | 212.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H12O6Si | Melting Point | 7 °C | |
| MSDS | Chinese USA | Flash Point | 82.2±27.3 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | Vinyltriacetoxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 212.3±40.0 °C at 760 mmHg |
| Melting Point | 7 °C |
| Molecular Formula | C8H12O6Si |
| Molecular Weight | 232.263 |
| Flash Point | 82.2±27.3 °C |
| Exact Mass | 232.040314 |
| PSA | 78.90000 |
| LogP | 0.33980 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | n20/D 1.422(lit.) |
| InChIKey | NOZAQBYNLKNDRT-UHFFFAOYSA-N |
| SMILES | C=C[Si](OC(C)=O)(OC(C)=O)OC(C)=O |
| Storage condition | below 5° C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R14;R34 |
| Safety Phrases | S26-S36/37/39-S45-S8 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2931900090 |
|
~%
2-Silyl-1,1,2-e... CAS#:4130-08-9 |
| Literature: Gmelin Handbook: Si: MVol.C, 69, page 190 - 194 |
|
~%
2-Silyl-1,1,2-e... CAS#:4130-08-9 |
| Literature: Doklady Akademii Nauk SSSR, , vol. 108, p. 83,86 Doklady Chemistry, 106-111 <1956> 207 Journal of the American Chemical Society, , vol. 74, p. 4584 |
|
~93%
2-Silyl-1,1,2-e... CAS#:4130-08-9 |
| Literature: Wakabayashi, Ryutaro; Sugiura, Yasushi; Shibue, Toshimichi; Kuroda, Kazuyuki Angewandte Chemie - International Edition, 2011 , vol. 50, # 45 p. 10708 - 10711 |
|
~%
2-Silyl-1,1,2-e... CAS#:4130-08-9 |
| Literature: Journal of Organic Chemistry, , vol. 26, p. 276 - 278 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Dow corning Z-6075 |
| Triacetoxy-vinyl-silan |
| H2C=CHSi(OAc)3 |
| ethenyl-silanetriol |
| Vinyltriacetoxysilicane |
| 1,1,2-Ethenetriol, 2-silyl-, triacetate |
| VTAsilane |
| CV-4800 |
| TRIACETOXYVINYLSILANE |
| MFCD00014975 |
| Triacetoxy(vinyl)silane |
| Z 6075 |
| 2-Silyl-1,1,2-ethenetriyl triacetate |
| AP-3000 |
| SZ-6075 |
| vinyl triacetoxysilane |
| EINECS 223-943-1 |
| 2-Silylethene-1,1,2-triyl triacetate |
| SH 6075 |