3-Fucosyllactose structure
|
Common Name | 3-Fucosyllactose | ||
|---|---|---|---|---|
| CAS Number | 41312-47-4 | Molecular Weight | 488.43800 | |
| Density | 1.73g/cm3 | Boiling Point | 803.2ºC at 760 mmHg | |
| Molecular Formula | C18H32O15 | Melting Point | >165°C (dec.) (lit.) | |
| MSDS | N/A | Flash Point | 439.6ºC | |
Use of 3-Fucosyllactose3-Fucosyllactose (3-Fucosyl-D-lactose) is one of the major fucosylated oligosaccharides found in human breast milk. 3-Fucosyllactose shows prebiotic, immunomodulator, neonatal brain development, and antimicrobial function[1]. |
| Name | (3R,4S)-4-[[(2S,6S)-6-methyl-2,6-dihydropyran-2-yl]oxy]-3,4-dihydro-2H-pyran-2,3-diol |
|---|
| Description | 3-Fucosyllactose (3-Fucosyl-D-lactose) is one of the major fucosylated oligosaccharides found in human breast milk. 3-Fucosyllactose shows prebiotic, immunomodulator, neonatal brain development, and antimicrobial function[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 3-Fucosyllactose (3-Fucosyl-D-lactose) (10 mg/mL) can inhibit the adhesion of enteric and respiratory pathogens to the human epithelial cell lines Caco-2 and A549[2]. |
| References |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 803.2ºC at 760 mmHg |
| Melting Point | >165°C (dec.) (lit.) |
| Molecular Formula | C18H32O15 |
| Molecular Weight | 488.43800 |
| Flash Point | 439.6ºC |
| Exact Mass | 488.17400 |
| PSA | 248.45000 |
| Vapour Pressure | 7.55E-30mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | WJPIUUDKRHCAEL-YVEAQFMBSA-N |
| SMILES | CC1OC(OC2C(O)C(O)OC(CO)C2OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| WGK Germany | 3 |
|---|