(NE)-N-[6-(3,4-dimethoxyphenyl)-7,8-dihydro-6H-benzo[f][1,3]benzodioxol-5-ylidene]hydroxylamine structure
|
Common Name | (NE)-N-[6-(3,4-dimethoxyphenyl)-7,8-dihydro-6H-benzo[f][1,3]benzodioxol-5-ylidene]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 41349-30-8 | Molecular Weight | 341.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (NE)-N-[6-(3,4-dimethoxyphenyl)-7,8-dihydro-6H-benzo[f][1,3]benzodioxol-5-ylidene]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H19NO5 |
|---|---|
| Molecular Weight | 341.35800 |
| Exact Mass | 341.12600 |
| PSA | 69.51000 |
| LogP | 3.34080 |
| InChIKey | JQEHLDMXRJMVNO-VXPUYCOJSA-N |
| SMILES | COc1ccc(C2CCc3cc4c(cc3C2=NO)OCO4)cc1OC |
|
~%
(NE)-N-[6-(3,4-... CAS#:41349-30-8 |
| Literature: Gopinath et al. Journal of the Chemical Society, 1959 , p. 4012 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-(3,4-dimethoxyphenyl)-6,7-methylenedioxy-3,4-dihydronaphthalene-1(2H)-oneoxime |
| 6-(3,4-Dimethoxy-phenyl)-7,8-dihydro-6H-naphtho[2,3-d][1,3]dioxol-5-on-oxim |
| 6-(3,4-dimethoxy-phenyl)-7,8-dihydro-6H-naphtho[2,3-d][1,3]dioxol-5-one oxime |